Products 82425-43-2
CAS 82425-43-2 appears in our catalog under these names: (-)Gomisin-L1, Gomisin L1, ≥95%, ≥95%, Gomisin L1. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
(9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-ol (CAS 82425-43-2) is a chemical compound with the molecular formula C22H26O6 and a molecular weight of 386.4 g/mol. IUPAC name: (9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-ol. InChIKey: OGJPBGDUYKEQLA-NWDGAFQWSA-N.
| Molecular formula | C22H26O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (9S,10R)-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-ol |
| InChIKey | OGJPBGDUYKEQLA-NWDGAFQWSA-N |
| SMILES | C[C@@H]1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C[C@@H]1C)OC)OC)O)OC)OCO3 |
Computed by PubChem (NCBI)