Products 82467-50-3
CAS 82467-50-3 appears in our catalog under these names: Gomisin M1, Gomisin M1, R(+)-Gomisin M1, R(+)-Gomisin M1, ≥98%, ≥98%, Gomisin M1, 99.56%. Offered by: Hubei YoungXin, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 2mg.
4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-ol (CAS 82467-50-3) is a chemical compound with the molecular formula C22H26O6 and a molecular weight of 386.4 g/mol. IUPAC name: 4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-ol. InChIKey: OGJPBGDUYKEQLA-UHFFFAOYSA-N.
| Molecular formula | C22H26O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-ol |
| InChIKey | OGJPBGDUYKEQLA-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1C)OC)OC)O)OC)OCO3 |
Computed by PubChem (NCBI)