cas: 82428-30-6 — see every product listed under this CAS number, including other names
7-Oxabicyclo[4.1.0]heptan-3-ylmethyl methacrylate, 96% (CAS 82428-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F764937-100G |
| cas | 82428-30-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 732.05 Pln | |
| Fluorochem | 1kg | 1278.73 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
[(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate (CAS 82428-30-6) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate. InChIKey: FYYIUODUDSPAJQ-XVBQNVSMSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate |
| InChIKey | FYYIUODUDSPAJQ-XVBQNVSMSA-N |
| SMILES | CC(=C)C(=O)OCC1CC[C@@H]2[C@H](C1)O2 |
Computed by PubChem (NCBI)