Products 82442-48-6
CAS 82442-48-6 appears in our catalog under these names: Arteannuin A, Qinghaosu I, 95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 1mg.
(1R,4R,7R,8S,12S)-7,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-10-en-3-one (CAS 82442-48-6) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: (1R,4R,7R,8S,12S)-7,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-10-en-3-one. InChIKey: VXAMURHMZFPMIP-BGOACCFOSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (1R,4R,7R,8S,12S)-7,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-10-en-3-one |
| InChIKey | VXAMURHMZFPMIP-BGOACCFOSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H]3[C@H]1CC=C([C@@H]3OC2=O)C |
Computed by PubChem (NCBI)