CAS 82679-55-8 is the registry number for Methyl (2r,3s)-2-amino-3-hydroxybutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl (2R,3S)-2-amino-3-hydroxybutanoate (CAS 82679-55-8) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: methyl (2R,3S)-2-amino-3-hydroxybutanoate. InChIKey: TVHCXXXXQNWQLP-IUYQGCFVSA-N.
| Molecular formula | C5H11NO3 |
|---|---|
| Molecular weight | 133.15 g/mol |
| IUPAC name | methyl (2R,3S)-2-amino-3-hydroxybutanoate |
| InChIKey | TVHCXXXXQNWQLP-IUYQGCFVSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC)N)O |
Computed by PubChem (NCBI)