CAS 827614-47-1 is the registry number for 1-(2,5-Dichlorophenyl)piperazinedihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 2g.
1-(2,5-dichlorophenyl)piperazine;dihydrochloride (CAS 827614-47-1) is a chemical compound with the molecular formula C10H14Cl4N2 and a molecular weight of 304.0 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)piperazine;dihydrochloride. InChIKey: CYCGXYKRUBKWHT-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl4N2 |
|---|---|
| Molecular weight | 304.0 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)piperazine;dihydrochloride |
| InChIKey | CYCGXYKRUBKWHT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC(=C2)Cl)Cl.Cl.Cl |
Computed by PubChem (NCBI)