CAS 82793-41-7 is the registry number for 2,2,3,4,4,5,5,6,6,7,7-Undecafluoro-1-heptanol. Offered by: TRC. Available pack sizes: 500mg.
2,2,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-ol (CAS 82793-41-7) is a chemical compound with the molecular formula C7H5F11O and a molecular weight of 314.10 g/mol. IUPAC name: 2,2,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-ol. InChIKey: UFQUKPRALAQKPN-UHFFFAOYSA-N.
| Molecular formula | C7H5F11O |
|---|---|
| Molecular weight | 314.10 g/mol |
| IUPAC name | 2,2,3,4,4,5,5,6,6,7,7-undecafluoroheptan-1-ol |
| InChIKey | UFQUKPRALAQKPN-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)F)(F)F)O |
Computed by PubChem (NCBI)