CAS 914637-05-1 appears in our catalog under these names: 3,3,4,4,5,5,6,6,7,7,7-Undecafluoroheptan-2-ol, 95%, 1H,1H,1H,2H-Perfluoro-2-heptanol, 3,3,4,4,5,5,6,6,7,7,7-Undecafluoroheptan-2-ol. Offered by: Combi-blocks, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 250mg, 1g, 25mg, 0,5g, 1x10mg.
3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-2-ol (CAS 914637-05-1) is a chemical compound with the molecular formula C7H5F11O and a molecular weight of 314.10 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-2-ol. InChIKey: QOYNEVFKTZVANM-UHFFFAOYSA-N.
| Molecular formula | C7H5F11O |
|---|---|
| Molecular weight | 314.10 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-2-ol |
| InChIKey | QOYNEVFKTZVANM-UHFFFAOYSA-N |
| SMILES | CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)