Products 82827-58-5
CAS 82827-58-5 appears in our catalog under these names: 5–(2–Bromoethoxy)–2，3–dihydro–1H–indene, 5-(2-Bromoethoxy)-2,3-dihydro-1h-indene, 95%, 5-(2-Bromoethoxy)-2,3-dihydro-1H-indene, 95+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
5-(2-bromoethoxy)-2,3-dihydro-1H-indene (CAS 82827-58-5) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 5-(2-bromoethoxy)-2,3-dihydro-1H-indene. InChIKey: BOGDZQBNXLDUMW-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 5-(2-bromoethoxy)-2,3-dihydro-1H-indene |
| InChIKey | BOGDZQBNXLDUMW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OCCBr |
Computed by PubChem (NCBI)