CAS 828273-14-9 is the registry number for 4-(4-(Difluoromethoxy)phenyl)pyrimidin-2-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine (CAS 828273-14-9) is a chemical compound with the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. IUPAC name: 4-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine. InChIKey: MQUXWDKURXLJBT-UHFFFAOYSA-N.
| Molecular formula | C11H9F2N3O |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 4-[4-(difluoromethoxy)phenyl]pyrimidin-2-amine |
| InChIKey | MQUXWDKURXLJBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC=C2)N)OC(F)F |
Computed by PubChem (NCBI)