CAS 86386-76-7 appears in our catalog under these names: Fluconazole EP Impurity G, 1-(2-(2,4-Difluorophenyl)-2,3-epoxypropyl)-1H-1,2,4-triazole, >95% (HPLC), 1-[2-(2,4-Difluorophenyl)-2,3-epoxypropyl]-1H-1,2,4-triazole 98%, 1-[2-(2,4-Difluorophenyl)-2,3-epoxypropyl]-1H-1,2,4-triazole, 98%, 98%. Offered by: Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: on request, 100mg, 1g, 500mg, 250mg.
1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (CAS 86386-76-7) is a chemical compound with the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. IUPAC name: 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole. InChIKey: UIXQTZYZQHYHRL-UHFFFAOYSA-N.
| Molecular formula | C11H9F2N3O |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 1-[[2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| InChIKey | UIXQTZYZQHYHRL-UHFFFAOYSA-N |
| SMILES | C1C(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)F)F |
Computed by PubChem (NCBI)