CAS 828300-44-3 is the registry number for rel-1-(1,1-Dimethylethyl) 3-ethyl (2R,3R)-2-methyl-1,3-piperidinedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-O-tert-butyl 3-O-ethyl (2R,3R)-2-methylpiperidine-1,3-dicarboxylate (CAS 828300-44-3) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (2R,3R)-2-methylpiperidine-1,3-dicarboxylate. InChIKey: AFRMOYXAWXMOTJ-GHMZBOCLSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (2R,3R)-2-methylpiperidine-1,3-dicarboxylate |
| InChIKey | AFRMOYXAWXMOTJ-GHMZBOCLSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCN([C@@H]1C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)