Products 82834-11-5

CAS 82834-11-5 is the registry number for Perindopril Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid (CAS 82834-11-5) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid. InChIKey: AUVAVXHAOCLQBF-JGVFFNPUSA-N.

Identity
Molecular formulaC10H19NO4
Molecular weight217.26 g/mol
IUPAC name(2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid
InChIKeyAUVAVXHAOCLQBF-JGVFFNPUSA-N
SMILESCCC[C@H](C(=O)OCC)N[C@@H](C)C(=O)O

Computed by PubChem (NCBI)