Products 82863-65-8
CAS 82863-65-8 appears in our catalog under these names: Cyclo(Tyr-L-Leu), Cyclo(Tyr-Leu), 98%, Cyclo(Tyr-Leu)/ 98.8% (existing batch purity), Cyclo(Tyr–Leu), Cyclo(Tyr-Leu). Offered by: Chemat Brand, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
3-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)piperazine-2,5-dione (CAS 82863-65-8) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: 3-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)piperazine-2,5-dione. InChIKey: GENSLUDVKWKQMX-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | 3-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)piperazine-2,5-dione |
| InChIKey | GENSLUDVKWKQMX-UHFFFAOYSA-N |
| SMILES | CC(C)CC1C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)