Products 82933-86-6
CAS 82933-86-6 is the registry number for Pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione, 5,6,7,8-tetrahydro-, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,6,7,8-tetrahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione (CAS 82933-86-6) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: 5,6,7,8-tetrahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione. InChIKey: WBYIWJRESUEMOL-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| InChIKey | WBYIWJRESUEMOL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)NC(=O)N2)NC1 |
Computed by PubChem (NCBI)