Products 83161-59-5
CAS 83161-59-5 is the registry number for Methyl pechueloate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (CAS 83161-59-5) is a chemical compound with the molecular formula C16H22O3 and a molecular weight of 262.34 g/mol. IUPAC name: methyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate. InChIKey: HCKPJXLKCCFLEX-BIMULSAOSA-N.
| Molecular formula | C16H22O3 |
|---|---|
| Molecular weight | 262.34 g/mol |
| IUPAC name | methyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| InChIKey | HCKPJXLKCCFLEX-BIMULSAOSA-N |
| SMILES | C[C@H]1CC[C@H](CC2=C(C(=O)C[C@@H]12)C)C(=C)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl pechueloate, orb1992449