CAS 83249-11-0 appears in our catalog under these names: 3-Phenylbicyclo[1.1.1]pentan-1-amine hydrochloride, 95%, 3-Phenylbicyclo(1.1.1)pentan-1-amine hydrochloride, 97%, 3-phenylbicyclo(1.1.1)pentan-1-amine hydrochloride, 3-Phenylbicyclo[1.1.1]pentan-1-amine hydrochloride, 97%, 97%, 3-phenylbicyclo[1.1.1]pentan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg, 500mg.
3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 83249-11-0) is a chemical compound with the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. IUPAC name: 3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: HZYVHMHCFPJPKT-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | 3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | HZYVHMHCFPJPKT-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)