Products 832738-07-5

CAS 832738-07-5 is the registry number for 4-((4-Bromo-2-chlorophenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-[(4-bromo-2-chlorophenoxy)methyl]benzoic acid (CAS 832738-07-5) is a chemical compound with the molecular formula C14H10BrClO3 and a molecular weight of 341.58 g/mol. IUPAC name: 4-[(4-bromo-2-chlorophenoxy)methyl]benzoic acid. InChIKey: XLFLHODVSITFAY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10BrClO3
Molecular weight341.58 g/mol
IUPAC name4-[(4-bromo-2-chlorophenoxy)methyl]benzoic acid
InChIKeyXLFLHODVSITFAY-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1COC2=C(C=C(C=C2)Br)Cl)C(=O)O

Computed by PubChem (NCBI)