CAS 938259-69-9 appears in our catalog under these names: 2-(2-Bromo-4-chlorophenoxy)-2-phenylacetic acid, 95%, 2-(2-Bromo-4-chlorophenoxy)-2-phenylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2-bromo-4-chlorophenoxy)-2-phenylacetic acid (CAS 938259-69-9) is a chemical compound with the molecular formula C14H10BrClO3 and a molecular weight of 341.58 g/mol. IUPAC name: 2-(2-bromo-4-chlorophenoxy)-2-phenylacetic acid. InChIKey: PYQBGHZZGUTMSS-UHFFFAOYSA-N.
| Molecular formula | C14H10BrClO3 |
|---|---|
| Molecular weight | 341.58 g/mol |
| IUPAC name | 2-(2-bromo-4-chlorophenoxy)-2-phenylacetic acid |
| InChIKey | PYQBGHZZGUTMSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC2=C(C=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)