CAS 83304-13-6 appears in our catalog under these names: 3-Nitrophenylethylamine, 97%, 2-(3-Nitrophenyl)ethanamine. Offered by: Combi-blocks, TRC. Available pack sizes: 25g, 1g, 5g, 10g, 2,5g, 500mg.
2-(3-nitrophenyl)ethanamine (CAS 83304-13-6) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-(3-nitrophenyl)ethanamine. InChIKey: WEPKDBHGQDETGY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-(3-nitrophenyl)ethanamine |
| InChIKey | WEPKDBHGQDETGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CCN |
Computed by PubChem (NCBI)