CAS 83417-23-6 appears in our catalog under these names: 5-(pyridin-2-yl)-4H-1,2,4-triazol-3-amine, 5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-amine, 98%, 98%, 5-(pyridin-2-yl)-4H-1,2,4-triazol-3-amine, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g, 500mg, 2.5g, 10g.
5-pyridin-2-yl-1H-1,2,4-triazol-3-amine (CAS 83417-23-6) is a chemical compound with the molecular formula C7H7N5 and a molecular weight of 161.16 g/mol. IUPAC name: 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine. InChIKey: VPTQEOQBSABCKV-UHFFFAOYSA-N.
| Molecular formula | C7H7N5 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine |
| InChIKey | VPTQEOQBSABCKV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=NN2)N |
Computed by PubChem (NCBI)