Products 83540-89-0
CAS 83540-89-0 is the registry number for 4,7-Anhydro-1,2,3-trideoxy-D-allo-oct-1-enitol. Offered by: Biosynth. Available pack sizes: 1g.
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-prop-2-enyloxolane-3,4-diol (CAS 83540-89-0) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: (2R,3S,4R,5S)-2-(hydroxymethyl)-5-prop-2-enyloxolane-3,4-diol. InChIKey: WBYPNGURMRKSNP-FKSUSPILSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-prop-2-enyloxolane-3,4-diol |
| InChIKey | WBYPNGURMRKSNP-FKSUSPILSA-N |
| SMILES | C=CC[C@H]1[C@@H]([C@@H]([C@H](O1)CO)O)O |
Computed by PubChem (NCBI)