CAS 83558-76-3 appears in our catalog under these names: Hexafluoro-2,2-diphenylpropane, 95%, Hexafluoro–2,2–diphenylpropane, Hexafluoro-2,2-diphenylpropane, >98.0%(GC), Hexafluoro-2,2-diphenylpropane, 98%+(GC-MS),RG, 98%+(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene (CAS 83558-76-3) is a chemical compound with the molecular formula C15H10F6 and a molecular weight of 304.23 g/mol. IUPAC name: (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene. InChIKey: CFTSORNHIUMCGF-UHFFFAOYSA-N.
| Molecular formula | C15H10F6 |
|---|---|
| Molecular weight | 304.23 g/mol |
| IUPAC name | (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene |
| InChIKey | CFTSORNHIUMCGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)