CAS 86845-35-4 appears in our catalog under these names: Bis(3-(trifluoromethyl)phenyl)methane, 95+%, Bis[3,3'-(trifluoromethyl)phenyl]methane, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
1-(trifluoromethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]benzene (CAS 86845-35-4) is a chemical compound with the molecular formula C15H10F6 and a molecular weight of 304.23 g/mol. IUPAC name: 1-(trifluoromethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]benzene. InChIKey: GXGZHSTYPHZGGN-UHFFFAOYSA-N.
| Molecular formula | C15H10F6 |
|---|---|
| Molecular weight | 304.23 g/mol |
| IUPAC name | 1-(trifluoromethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]benzene |
| InChIKey | GXGZHSTYPHZGGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)