CAS 83660-06-4 appears in our catalog under these names: 2-Bromodibenzo(b,d)furan-3-amine, 98%, 2-Bromodibenzo[b,d]furan-3-amine, 98%, 98%, 2-Bromodibenzo[b,d]furan-3-amine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-bromodibenzofuran-3-amine (CAS 83660-06-4) is a chemical compound with the molecular formula C12H8BrNO and a molecular weight of 262.10 g/mol. IUPAC name: 2-bromodibenzofuran-3-amine. InChIKey: CQJRPRPVUGPJSF-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 2-bromodibenzofuran-3-amine |
| InChIKey | CQJRPRPVUGPJSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=C(C=C3O2)N)Br |
Computed by PubChem (NCBI)