CAS 837430-15-6 is the registry number for 1-(Pyrazin-2-yl)-2-trifluoroacetyl Hydrazine. Offered by: TRC. Available pack sizes: 25mg.
2,2,2-trifluoro-N'-pyrazin-2-ylacetohydrazide (CAS 837430-15-6) is a chemical compound with the molecular formula C6H5F3N4O and a molecular weight of 206.13 g/mol. IUPAC name: 2,2,2-trifluoro-N'-pyrazin-2-ylacetohydrazide. InChIKey: LXAMIEHRHJSCKX-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N4O |
|---|---|
| Molecular weight | 206.13 g/mol |
| IUPAC name | 2,2,2-trifluoro-N'-pyrazin-2-ylacetohydrazide |
| InChIKey | LXAMIEHRHJSCKX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)NNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)