CAS 83783-33-9 appears in our catalog under these names: 3–Formyl–1H–indole–6–carbonitrile, 3-Formyl-1H-indole-6-carbonitrile, 95%, 95%, 3-Formyl-1H-indole-6-carbonitrile, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
3-formyl-1H-indole-6-carbonitrile (CAS 83783-33-9) is a chemical compound with the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. IUPAC name: 3-formyl-1H-indole-6-carbonitrile. InChIKey: KCNWLZZKKCXGOC-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-formyl-1H-indole-6-carbonitrile |
| InChIKey | KCNWLZZKKCXGOC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC=C2C=O |
Computed by PubChem (NCBI)