Products 83808-07-5
CAS 83808-07-5 is the registry number for (1R)-4-bromo-2,3-dihydro-1H-inden-1-ol, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
(1R)-4-bromo-2,3-dihydro-1H-inden-1-ol (CAS 83808-07-5) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: (1R)-4-bromo-2,3-dihydro-1H-inden-1-ol. InChIKey: RNXQQZNOSYBFTN-SECBINFHSA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | (1R)-4-bromo-2,3-dihydro-1H-inden-1-ol |
| InChIKey | RNXQQZNOSYBFTN-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1O)C=CC=C2Br |
Computed by PubChem (NCBI)