CAS 83808-19-9 appears in our catalog under these names: (S)–4–Bromo–2,3–dihydro–1H–inden–1–ol, (S)-4-Bromo-2,3-dihydro-1H-inden-1-ol, 95%, 95%, (S)-4-Bromo-2,3-dihydro-1H-inden-1-ol, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(1S)-4-bromo-2,3-dihydro-1H-inden-1-ol (CAS 83808-19-9) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: (1S)-4-bromo-2,3-dihydro-1H-inden-1-ol. InChIKey: RNXQQZNOSYBFTN-VIFPVBQESA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | (1S)-4-bromo-2,3-dihydro-1H-inden-1-ol |
| InChIKey | RNXQQZNOSYBFTN-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1O)C=CC=C2Br |
Computed by PubChem (NCBI)