CAS 83834-10-0 appears in our catalog under these names: 3,7–Dibromodibenzo(b,d)thiophene, 3,7-Dibromodibenzo(b,d)thiophene, 3,7-Dibromodibenzo[b,d]thiophene, >96.0%(GC), 3,7-Dibromodibenzo[b,d]thiophene 95%, 3,7-Dibromodibenzothiophene, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 2g, 200mg, 10g, 25g, 100g, 100mg.
3,7-dibromodibenzothiophene (CAS 83834-10-0) is a chemical compound with the molecular formula C12H6Br2S and a molecular weight of 342.05 g/mol. IUPAC name: 3,7-dibromodibenzothiophene. InChIKey: KMNBVODPWIFUSS-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2S |
|---|---|
| Molecular weight | 342.05 g/mol |
| IUPAC name | 3,7-dibromodibenzothiophene |
| InChIKey | KMNBVODPWIFUSS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)