CAS 84-67-3 appears in our catalog under these names: 2,2'-Dimethyl-(1,1'-biphenyl)-4,4'-diamine, >95% (HPLC), m–Tolidine, m-Tolidine, >98.0%(GC)(T), 2,2'-Dimethyl-[1,1'-biphenyl]-4,4'-diamine 97%, 2,2'-dimethyl-4,4'-diaminobiphenyl, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 500g, 25g, 1000g, 5g.
4-(4-amino-2-methylphenyl)-3-methylaniline (CAS 84-67-3) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 4-(4-amino-2-methylphenyl)-3-methylaniline. InChIKey: QYIMZXITLDTULQ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 4-(4-amino-2-methylphenyl)-3-methylaniline |
| InChIKey | QYIMZXITLDTULQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)