CAS 84086-96-4 is the registry number for 3,7-Dichloro-8-(chloromethyl)quinoline. Offered by: HPC Standards. Available pack sizes: 1x10mg.
3,7-dichloro-8-(chloromethyl)quinoline (CAS 84086-96-4) is a chemical compound with the molecular formula C10H6Cl3N and a molecular weight of 246.5 g/mol. IUPAC name: 3,7-dichloro-8-(chloromethyl)quinoline. InChIKey: SQQMOCHTAKMTGJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 3,7-dichloro-8-(chloromethyl)quinoline |
| InChIKey | SQQMOCHTAKMTGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C=C21)Cl)CCl)Cl |
Computed by PubChem (NCBI)