CAS 84120-83-2 is the registry number for Dl-alpha-methyltryptophan methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate;hydrochloride (CAS 84120-83-2) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: methyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate;hydrochloride. InChIKey: RSEARSAHSASEAP-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | methyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate;hydrochloride |
| InChIKey | RSEARSAHSASEAP-UHFFFAOYSA-N |
| SMILES | CC(CC1=CNC2=CC=CC=C21)(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)