Products 84120-83-2

CAS 84120-83-2 is the registry number for Dl-alpha-methyltryptophan methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate;hydrochloride (CAS 84120-83-2) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: methyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate;hydrochloride. InChIKey: RSEARSAHSASEAP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17ClN2O2
Molecular weight268.74 g/mol
IUPAC namemethyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate;hydrochloride
InChIKeyRSEARSAHSASEAP-UHFFFAOYSA-N
SMILESCC(CC1=CNC2=CC=CC=C21)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)