CAS 841259-41-4 appears in our catalog under these names: 8-Bromonaphthalene-2-carbaldehyde, 95%, 8-Bromo-2-naphthaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
8-bromonaphthalene-2-carbaldehyde (CAS 841259-41-4) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 8-bromonaphthalene-2-carbaldehyde. InChIKey: VSNWXSUIVXFFQN-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 8-bromonaphthalene-2-carbaldehyde |
| InChIKey | VSNWXSUIVXFFQN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)C=O)C(=C1)Br |
Computed by PubChem (NCBI)