CAS 50672-84-9 appears in our catalog under these names: 4-Bromo-1-napthaldehyde, >95% (HPLC), 4–Bromo–1–naphthaldehyde, 4-Bromo-1-napthaldehyde, 4-Bromo-1-naphthaldehyde 97%, 4-Bromo-1-naphthaldehyde, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 50g, 1g, 5g, 100g, 100mg, 250mg, 25g.
4-bromonaphthalene-1-carbaldehyde (CAS 50672-84-9) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 4-bromonaphthalene-1-carbaldehyde. InChIKey: SESASPRCAIMYLA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 4-bromonaphthalene-1-carbaldehyde |
| InChIKey | SESASPRCAIMYLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)C=O |
Computed by PubChem (NCBI)