CAS 84131-91-9 is the registry number for (S)-(+)-2-Methylbutyric anhydride, 95%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
[(2S)-2-methylbutanoyl] (2S)-2-methylbutanoate (CAS 84131-91-9) is a chemical compound with the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. IUPAC name: [(2S)-2-methylbutanoyl] (2S)-2-methylbutanoate. InChIKey: WRTPVONNQPWNRH-YUMQZZPRSA-N.
| Molecular formula | C10H18O3 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | [(2S)-2-methylbutanoyl] (2S)-2-methylbutanoate |
| InChIKey | WRTPVONNQPWNRH-YUMQZZPRSA-N |
| SMILES | CC[C@H](C)C(=O)OC(=O)[C@@H](C)CC |
Computed by PubChem (NCBI)