Products 84272-84-4
CAS 84272-84-4 appears in our catalog under these names: 3'-O-Angeloylhamaudol, ≥98%, ≥98%, 3′-O-Angeloylhamaudol, 98.87%. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
[(3S)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (Z)-2-methylbut-2-enoate (CAS 84272-84-4) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: [(3S)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (Z)-2-methylbut-2-enoate. InChIKey: GLVOOJKVWKZSGR-DIEDAUMRSA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | [(3S)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | GLVOOJKVWKZSGR-DIEDAUMRSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H]1CC2=C(C=C3C(=C2O)C(=O)C=C(O3)C)OC1(C)C |
Computed by PubChem (NCBI)