CAS 842975-38-6 appears in our catalog under these names: 3-(4-(N-Methylsulfamoyl)phenyl)propanoic acid, 95%, 3-(4-Methylsulfamoyl-phenyl)-propionic acid, 3-(4-(N-Methylsulfamoyl)phenyl)propanoic acid, 95%, 95%, 3-[4-(methylsulfamoyl)phenyl]propanoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[4-(methylsulfamoyl)phenyl]propanoic acid (CAS 842975-38-6) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 3-[4-(methylsulfamoyl)phenyl]propanoic acid. InChIKey: RWDZHAQPBLATJP-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 3-[4-(methylsulfamoyl)phenyl]propanoic acid |
| InChIKey | RWDZHAQPBLATJP-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)