CAS 844-15-5 is the registry number for 7-Chloro-5-(2-fluorophenyl)-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-5-(2-fluorophenyl)-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one (CAS 844-15-5) is a chemical compound with the molecular formula C15H12ClFN2O and a molecular weight of 290.72 g/mol. IUPAC name: 7-chloro-5-(2-fluorophenyl)-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one. InChIKey: LZIAQNOAIDLPMN-UHFFFAOYSA-N.
| Molecular formula | C15H12ClFN2O |
|---|---|
| Molecular weight | 290.72 g/mol |
| IUPAC name | 7-chloro-5-(2-fluorophenyl)-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one |
| InChIKey | LZIAQNOAIDLPMN-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Cl)C(N1)C3=CC=CC=C3F |
Computed by PubChem (NCBI)