CAS 871218-91-6 appears in our catalog under these names: 2-(2-Chloro-4-fluorophenoxymethyl)-8-methylimidazo(1,2-a)pyridine, 95%, 2-(2-Chloro-4-fluorophenoxymethyl)-8-methylimidazo(1,2-a)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-[(2-chloro-4-fluorophenoxy)methyl]-8-methylimidazo[1,2-a]pyridine (CAS 871218-91-6) is a chemical compound with the molecular formula C15H12ClFN2O and a molecular weight of 290.72 g/mol. IUPAC name: 2-[(2-chloro-4-fluorophenoxy)methyl]-8-methylimidazo[1,2-a]pyridine. InChIKey: KYQJFRYOHIIHQX-UHFFFAOYSA-N.
| Molecular formula | C15H12ClFN2O |
|---|---|
| Molecular weight | 290.72 g/mol |
| IUPAC name | 2-[(2-chloro-4-fluorophenoxy)methyl]-8-methylimidazo[1,2-a]pyridine |
| InChIKey | KYQJFRYOHIIHQX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)COC3=C(C=C(C=C3)F)Cl |
Computed by PubChem (NCBI)