CAS 84499-76-3 appears in our catalog under these names: (1S)-1-(3,5-Dimethylphenyl)ethylamine, 95%, (S)–1–(3,5–Dimethylphenyl)ethanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-(3,5-dimethylphenyl)ethanamine (CAS 84499-76-3) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: (1S)-1-(3,5-dimethylphenyl)ethanamine. InChIKey: BWGRGXSRUZMWFO-VIFPVBQESA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | (1S)-1-(3,5-dimethylphenyl)ethanamine |
| InChIKey | BWGRGXSRUZMWFO-VIFPVBQESA-N |
| SMILES | CC1=CC(=CC(=C1)[C@H](C)N)C |
Computed by PubChem (NCBI)