CAS 91251-31-9 appears in our catalog under these names: 1-(3,5-Dimethylphenyl)ethan-1-amine, 95%, 1-(3,5-Dimethylphenyl)ethan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
(1R)-1-(3,5-dimethylphenyl)ethanamine (CAS 91251-31-9) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: (1R)-1-(3,5-dimethylphenyl)ethanamine. InChIKey: BWGRGXSRUZMWFO-SECBINFHSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | (1R)-1-(3,5-dimethylphenyl)ethanamine |
| InChIKey | BWGRGXSRUZMWFO-SECBINFHSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H](C)N)C |
Computed by PubChem (NCBI)