CAS 84552-63-6 appears in our catalog under these names: (S)-tert-Butyl 1-((S)-2-amino-3-(4-hydroxyphenyl)propanoyl)pyrrolidine-2-carboxylate, 97%, H–Tyr–Pro–OBut. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylate (CAS 84552-63-6) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: tert-butyl (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylate. InChIKey: AYENTTBACYFCMH-GJZGRUSLSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | tert-butyl (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylate |
| InChIKey | AYENTTBACYFCMH-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)[C@H](CC2=CC=C(C=C2)O)N |
Computed by PubChem (NCBI)