CAS 845551-45-3 appears in our catalog under these names: 3-(2'-Chlorobenzyloxy)phenylboronic acid, 98%, (3–((2–Chlorobenzyl)oxy)phenyl)boronic acid, (3-((2-Chlorobenzyl)oxy)phenyl)boronic acid 98%, (3-((2-Chlorobenzyl)oxy)phenyl)boronic acid, 95%, (3-((2-Chlorobenzyl)oxy)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
[3-[(2-chlorophenyl)methoxy]phenyl]boronic acid (CAS 845551-45-3) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: [3-[(2-chlorophenyl)methoxy]phenyl]boronic acid. InChIKey: XHGOCNFADOJUMW-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | [3-[(2-chlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | XHGOCNFADOJUMW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC=CC=C2Cl)(O)O |
Computed by PubChem (NCBI)