CAS 870778-90-8 is the registry number for 3-(4'-Chlorobenzyloxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 25g.
[3-[(4-chlorophenyl)methoxy]phenyl]boronic acid (CAS 870778-90-8) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: [3-[(4-chlorophenyl)methoxy]phenyl]boronic acid. InChIKey: TYILTVKJHDWCKU-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | [3-[(4-chlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | TYILTVKJHDWCKU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)