Products 845645-46-7
CAS 845645-46-7 appears in our catalog under these names: 1-(4-Chlorophenyl)-4-piperidinecarboxylic acid, 95%, 1-(4-Chlorophenyl)piperidine-4-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-chlorophenyl)piperidine-4-carboxylic acid (CAS 845645-46-7) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: 1-(4-chlorophenyl)piperidine-4-carboxylic acid. InChIKey: BWBDUUYXWHNBJW-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)piperidine-4-carboxylic acid |
| InChIKey | BWBDUUYXWHNBJW-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)