CAS 84574-05-0 is the registry number for 2,2,4,6,7-Pentamethyl-2,3-dihydro-1-benzofuran-5-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol (CAS 84574-05-0) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol. InChIKey: WOQBRTRMLPJSGR-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol |
| InChIKey | WOQBRTRMLPJSGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CC(O2)(C)C)C(=C1O)C)C |
Computed by PubChem (NCBI)