Products 845746-35-2
CAS 845746-35-2 appears in our catalog under these names: 2,4-Bis(4-(tert-butyl)phenyl)-1H-pyrrole, 98%, 98%, 2,4-Bis(4-(tert-butyl)phenyl)-1H-pyrrole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-bis(4-tert-butylphenyl)-1H-pyrrole (CAS 845746-35-2) is a chemical compound with the molecular formula C24H29N and a molecular weight of 331.5 g/mol. IUPAC name: 2,4-bis(4-tert-butylphenyl)-1H-pyrrole. InChIKey: OKBSDYLCRUOJQK-UHFFFAOYSA-N.
| Molecular formula | C24H29N |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | 2,4-bis(4-tert-butylphenyl)-1H-pyrrole |
| InChIKey | OKBSDYLCRUOJQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC(=CN2)C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)