Products 84585-84-2
CAS 84585-84-2 is the registry number for rac-methyl (1R,2R)-2-carbamoylcyclobutane-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-methyl (1R,2R)-2-carbamoylcyclobutane-1-carboxylate (CAS 84585-84-2) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: trans-methyl (1R,2R)-2-carbamoylcyclobutane-1-carboxylate. InChIKey: VYGBQRJJFRROAW-RFZPGFLSSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | trans-methyl (1R,2R)-2-carbamoylcyclobutane-1-carboxylate |
| InChIKey | VYGBQRJJFRROAW-RFZPGFLSSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H]1C(=O)N |
Computed by PubChem (NCBI)