CAS 84613-97-8 appears in our catalog under these names: 1,2-dichloro-3-(trichloromethyl)benzene, Nintedanib Impurity 143. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,2-dichloro-3-(trichloromethyl)benzene (CAS 84613-97-8) is a chemical compound with the molecular formula C7H3Cl5 and a molecular weight of 264.4 g/mol. IUPAC name: 1,2-dichloro-3-(trichloromethyl)benzene. InChIKey: GKGPLSQWIBJJPC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl5 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1,2-dichloro-3-(trichloromethyl)benzene |
| InChIKey | GKGPLSQWIBJJPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)